C20H15N5O3S2 — CID 39835893
(12R,13R)-12-(4-nitrophenyl)sulfanyl-13-phenyl-10-thia-1,3,4,8-tetrazatricyclo[7.4.0.02,6]trideca-2(6),4,8-trien-7-one (PubChem CID 39835893) has the molecular formula C20H15N5O3S2 and a molecular weight of 437.51 g/mol. Its IUPAC name is (12R,13R)-12-(4-nitrophenyl)sulfanyl-13-phenyl-10-thia-1,3,4,8-tetrazatricyclo[7.4.0.02,6]trideca-2(6),4,8-trien-7-one.
| Compound Name | (12R,13R)-12-(4-nitrophenyl)sulfanyl-13-phenyl-10-thia-1,3,4,8-tetrazatricyclo[7.4.0.02,6]trideca-2(6),4,8-trien-7-one |
|---|---|
| PubChem CID | 39835893 |
| Molecular Formula | C20H15N5O3S2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | (12R,13R)-12-(4-nitrophenyl)sulfanyl-13-phenyl-10-thia-1,3,4,8-tetrazatricyclo[7.4.0.02,6]trideca-2(6),4,8-trien-7-one |
| SMILES | O=c1nc2n(c3[nH]ncc13)[C@H](c1ccccc1)[C@@H](Sc1ccc([N+](=O)[O-])cc1)CS2 |
| InChI | InChI=1S/C20H15N5O3S2/c26-19-15-10-21-23-18(15)24-17(12-4-2-1-3-5-12)16(11-29-20(24)22-19)30-14-8-6-13(7-9-14)25(27)28/h1-10,16-17H,11H2,(H,21,23)/t16-,17+/m0/s1 |
| InChIKey | BLPPGPYKUIPODE-DLBZAZTESA-N |
| XLogP | 3.88 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|