C21H25N3O8 — CID 3132859
4-[6-(4-hydroxy-3-methoxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]-2-methoxyphenol (PubChem CID 3132859) has the molecular formula C21H25N3O8 and a molecular weight of 447.44 g/mol. Its IUPAC name is 4-[6-(4-hydroxy-3-methoxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]-2-methoxyphenol.
| Compound Name | 4-[6-(4-hydroxy-3-methoxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 3132859 |
| Molecular Formula | C21H25N3O8 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 4-[6-(4-hydroxy-3-methoxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]-2-methoxyphenol |
| SMILES | COc1cc(C2NC(c3ccc(O)c(OC)c3)C([N+](=O)[O-])C(C)(C)C2[N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C21H25N3O8/c1-21(2)19(23(27)28)17(11-5-7-13(25)15(9-11)31-3)22-18(20(21)24(29)30)12-6-8-14(26)16(10-12)32-4/h5-10,17-20,22,25-26H,1-4H3 |
| InChIKey | LWFVMHYOVYRDHE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 157.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|