C15H25Cl3O3 — CID 70525185
[3-chloro-2,2-bis(1-chloroethyl)-1-cyclohexylbutyl] hydrogen carbonate (PubChem CID 70525185) has the molecular formula C15H25Cl3O3 and a molecular weight of 359.72 g/mol. Its IUPAC name is [3-chloro-2,2-bis(1-chloroethyl)-1-cyclohexylbutyl] hydrogen carbonate.
| Compound Name | [3-chloro-2,2-bis(1-chloroethyl)-1-cyclohexylbutyl] hydrogen carbonate |
|---|---|
| PubChem CID | 70525185 |
| Molecular Formula | C15H25Cl3O3 |
| Molecular Weight | 359.72 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | [3-chloro-2,2-bis(1-chloroethyl)-1-cyclohexylbutyl] hydrogen carbonate |
| SMILES | CC(Cl)C(C(C)Cl)(C(C)Cl)C(OC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C15H25Cl3O3/c1-9(16)15(10(2)17,11(3)18)13(21-14(19)20)12-7-5-4-6-8-12/h9-13H,4-8H2,1-3H3,(H,19,20) |
| InChIKey | PRUHRILJHPZWND-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|