C16H27Cl3O3 — CID 20558382
[3-chloro-2,2-bis(1-chloroethyl)-1-cyclohexylbutyl] methyl carbonate (PubChem CID 20558382) has the molecular formula C16H27Cl3O3 and a molecular weight of 373.75 g/mol. Its IUPAC name is [3-chloro-2,2-bis(1-chloroethyl)-1-cyclohexylbutyl] methyl carbonate.
| Compound Name | [3-chloro-2,2-bis(1-chloroethyl)-1-cyclohexylbutyl] methyl carbonate |
|---|---|
| PubChem CID | 20558382 |
| Molecular Formula | C16H27Cl3O3 |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [3-chloro-2,2-bis(1-chloroethyl)-1-cyclohexylbutyl] methyl carbonate |
| SMILES | COC(=O)OC(C1CCCCC1)C(C(C)Cl)(C(C)Cl)C(C)Cl |
| InChI | InChI=1S/C16H27Cl3O3/c1-10(17)16(11(2)18,12(3)19)14(22-15(20)21-4)13-8-6-5-7-9-13/h10-14H,5-9H2,1-4H3 |
| InChIKey | UAFVLFYVXBRCMT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|