C17H27N3O4 — CID 70528219
7-amino-2,2-dimethyl-6-nitro-4-piperidin-1-yl-3,4-dihydrochromen-3-ol;methane (PubChem CID 70528219) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 7-amino-2,2-dimethyl-6-nitro-4-piperidin-1-yl-3,4-dihydrochromen-3-ol;methane.
| Compound Name | 7-amino-2,2-dimethyl-6-nitro-4-piperidin-1-yl-3,4-dihydrochromen-3-ol;methane |
|---|---|
| PubChem CID | 70528219 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 7-amino-2,2-dimethyl-6-nitro-4-piperidin-1-yl-3,4-dihydrochromen-3-ol;methane |
| SMILES | C.CC1(C)Oc2cc(N)c([N+](=O)[O-])cc2C(N2CCCCC2)C1O |
| InChI | InChI=1S/C16H23N3O4.CH4/c1-16(2)15(20)14(18-6-4-3-5-7-18)10-8-12(19(21)22)11(17)9-13(10)23-16;/h8-9,14-15,20H,3-7,17H2,1-2H3;1H4 |
| InChIKey | BJQYFRUCVGREBY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|