C26H33NO5 — CID 70528321
3-(2-methyl-1-phenylpropan-2-yl)-5-[[2-(2-prop-2-enoxyethoxymethyl)phenoxy]methyl]-1,3-oxazolidin-2-one (PubChem CID 70528321) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is 3-(2-methyl-1-phenylpropan-2-yl)-5-[[2-(2-prop-2-enoxyethoxymethyl)phenoxy]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-(2-methyl-1-phenylpropan-2-yl)-5-[[2-(2-prop-2-enoxyethoxymethyl)phenoxy]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70528321 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 3-(2-methyl-1-phenylpropan-2-yl)-5-[[2-(2-prop-2-enoxyethoxymethyl)phenoxy]methyl]-1,3-oxazolidin-2-one |
| SMILES | C=CCOCCOCc1ccccc1OCC1CN(C(C)(C)Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C26H33NO5/c1-4-14-29-15-16-30-19-22-12-8-9-13-24(22)31-20-23-18-27(25(28)32-23)26(2,3)17-21-10-6-5-7-11-21/h4-13,23H,1,14-20H2,2-3H3 |
| InChIKey | LMASKABKFKENQS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|