C18H21Cl3N2O3 — CID 70528760
N,N-dimethyl-2-nitro-5-(2,4,6-trichlorophenyl)aniline;ethoxyethane (PubChem CID 70528760) has the molecular formula C18H21Cl3N2O3 and a molecular weight of 419.74 g/mol. Its IUPAC name is N,N-dimethyl-2-nitro-5-(2,4,6-trichlorophenyl)aniline;ethoxyethane.
| Compound Name | N,N-dimethyl-2-nitro-5-(2,4,6-trichlorophenyl)aniline;ethoxyethane |
|---|---|
| PubChem CID | 70528760 |
| Molecular Formula | C18H21Cl3N2O3 |
| Molecular Weight | 419.74 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N,N-dimethyl-2-nitro-5-(2,4,6-trichlorophenyl)aniline;ethoxyethane |
| SMILES | CCOCC.CN(C)c1cc(-c2c(Cl)cc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11Cl3N2O2.C4H10O/c1-18(2)13-5-8(3-4-12(13)19(20)21)14-10(16)6-9(15)7-11(14)17;1-3-5-4-2/h3-7H,1-2H3;3-4H2,1-2H3 |
| InChIKey | SAJVAPWVEAHLRQ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|