C31H34N2O6 — CID 70531926
but-2-enedioic acid;N-[3-[4-(2-methoxyphenoxy)-3,6-dihydro-2H-pyridin-1-yl]propyl]-N-phenylaniline (PubChem CID 70531926) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is but-2-enedioic acid;N-[3-[4-(2-methoxyphenoxy)-3,6-dihydro-2H-pyridin-1-yl]propyl]-N-phenylaniline.
| Compound Name | but-2-enedioic acid;N-[3-[4-(2-methoxyphenoxy)-3,6-dihydro-2H-pyridin-1-yl]propyl]-N-phenylaniline |
|---|---|
| PubChem CID | 70531926 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | but-2-enedioic acid;N-[3-[4-(2-methoxyphenoxy)-3,6-dihydro-2H-pyridin-1-yl]propyl]-N-phenylaniline |
| SMILES | COc1ccccc1OC1=CCN(CCCN(c2ccccc2)c2ccccc2)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C27H30N2O2.C4H4O4/c1-30-26-15-8-9-16-27(26)31-25-17-21-28(22-18-25)19-10-20-29(23-11-4-2-5-12-23)24-13-6-3-7-14-24;5-3(6)1-2-4(7)8/h2-9,11-17H,10,18-22H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | LWKZJBLOZAVEJR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|