C43H67N3 — CID 70535531
6-[4-[bis[4-(6-amino-2-methylheptan-2-yl)phenyl]methyl]phenyl]-6-methylheptan-2-amine (PubChem CID 70535531) has the molecular formula C43H67N3 and a molecular weight of 626.03 g/mol. Its IUPAC name is 6-[4-[bis[4-(6-amino-2-methylheptan-2-yl)phenyl]methyl]phenyl]-6-methylheptan-2-amine.
| Compound Name | 6-[4-[bis[4-(6-amino-2-methylheptan-2-yl)phenyl]methyl]phenyl]-6-methylheptan-2-amine |
|---|---|
| PubChem CID | 70535531 |
| Molecular Formula | C43H67N3 |
| Molecular Weight | 626.03 g/mol |
| Exact Mass | 625.53 |
| IUPAC Name | 6-[4-[bis[4-(6-amino-2-methylheptan-2-yl)phenyl]methyl]phenyl]-6-methylheptan-2-amine |
| SMILES | CC(N)CCCC(C)(C)c1ccc(C(c2ccc(C(C)(C)CCCC(C)N)cc2)c2ccc(C(C)(C)CCCC(C)N)cc2)cc1 |
| InChI | InChI=1S/C43H67N3/c1-31(44)13-10-28-41(4,5)37-22-16-34(17-23-37)40(35-18-24-38(25-19-35)42(6,7)29-11-14-32(2)45)36-20-26-39(27-21-36)43(8,9)30-12-15-33(3)46/h16-27,31-33,40H,10-15,28-30,44-46H2,1-9H3 |
| InChIKey | SQMQBOKHUSUMGI-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.03 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|