C13H11ClN4 — CID 705362
3-chloro-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)aniline (PubChem CID 705362) has the molecular formula C13H11ClN4 and a molecular weight of 258.71 g/mol. Its IUPAC name is 3-chloro-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)aniline.
| Compound Name | 3-chloro-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 705362 |
| Molecular Formula | C13H11ClN4 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-chloro-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)aniline |
| SMILES | Clc1cccc(NCc2cn3cccnc3n2)c1 |
| InChI | InChI=1S/C13H11ClN4/c14-10-3-1-4-11(7-10)16-8-12-9-18-6-2-5-15-13(18)17-12/h1-7,9,16H,8H2 |
| InChIKey | KYISUYUYLNWTFF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |