C20H27NO4 — CID 70538797
benzyl 3-[cyclohexanecarbonyl(methyl)amino]-4-oxopentanoate (PubChem CID 70538797) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is benzyl 3-[cyclohexanecarbonyl(methyl)amino]-4-oxopentanoate.
| Compound Name | benzyl 3-[cyclohexanecarbonyl(methyl)amino]-4-oxopentanoate |
|---|---|
| PubChem CID | 70538797 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | benzyl 3-[cyclohexanecarbonyl(methyl)amino]-4-oxopentanoate |
| SMILES | CC(=O)C(CC(=O)OCc1ccccc1)N(C)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H27NO4/c1-15(22)18(21(2)20(24)17-11-7-4-8-12-17)13-19(23)25-14-16-9-5-3-6-10-16/h3,5-6,9-10,17-18H,4,7-8,11-14H2,1-2H3 |
| InChIKey | JZQUGDSQOPNSAO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |