C10H7BrCl2S — CID 70540703
6-bromo-3-(2,2-dichloroethyl)-1-benzothiophene (PubChem CID 70540703) has the molecular formula C10H7BrCl2S and a molecular weight of 310.04 g/mol. Its IUPAC name is 6-bromo-3-(2,2-dichloroethyl)-1-benzothiophene.
| Compound Name | 6-bromo-3-(2,2-dichloroethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 70540703 |
| Molecular Formula | C10H7BrCl2S |
| Molecular Weight | 310.04 g/mol |
| Exact Mass | 307.88 |
| IUPAC Name | 6-bromo-3-(2,2-dichloroethyl)-1-benzothiophene |
| SMILES | ClC(Cl)Cc1csc2cc(Br)ccc12 |
| InChI | InChI=1S/C10H7BrCl2S/c11-7-1-2-8-6(3-10(12)13)5-14-9(8)4-7/h1-2,4-5,10H,3H2 |
| InChIKey | YYSNJCRZIXNLMS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.04 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|