C19H19BrClNOS — CID 139692015
2-[1-(6-bromo-1-benzothiophen-3-yl)propan-2-ylamino]-1-(3-chlorophenyl)ethanol (PubChem CID 139692015) has the molecular formula C19H19BrClNOS and a molecular weight of 424.79 g/mol. Its IUPAC name is 2-[1-(6-bromo-1-benzothiophen-3-yl)propan-2-ylamino]-1-(3-chlorophenyl)ethanol.
| Compound Name | 2-[1-(6-bromo-1-benzothiophen-3-yl)propan-2-ylamino]-1-(3-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 139692015 |
| Molecular Formula | C19H19BrClNOS |
| Molecular Weight | 424.79 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 2-[1-(6-bromo-1-benzothiophen-3-yl)propan-2-ylamino]-1-(3-chlorophenyl)ethanol |
| SMILES | CC(Cc1csc2cc(Br)ccc12)NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19BrClNOS/c1-12(22-10-18(23)13-3-2-4-16(21)8-13)7-14-11-24-19-9-15(20)5-6-17(14)19/h2-6,8-9,11-12,18,22-23H,7,10H2,1H3 |
| InChIKey | MXURYVXHHASQRD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.79 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |