C19H20ClNOS — CID 139692021
1-(3-chlorophenyl)-2-[2-(6-methyl-1-benzothiophen-3-yl)ethylamino]ethanol (PubChem CID 139692021) has the molecular formula C19H20ClNOS and a molecular weight of 345.90 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[2-(6-methyl-1-benzothiophen-3-yl)ethylamino]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[2-(6-methyl-1-benzothiophen-3-yl)ethylamino]ethanol |
|---|---|
| PubChem CID | 139692021 |
| Molecular Formula | C19H20ClNOS |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[2-(6-methyl-1-benzothiophen-3-yl)ethylamino]ethanol |
| SMILES | Cc1ccc2c(CCNCC(O)c3cccc(Cl)c3)csc2c1 |
| InChI | InChI=1S/C19H20ClNOS/c1-13-5-6-17-15(12-23-19(17)9-13)7-8-21-11-18(22)14-3-2-4-16(20)10-14/h2-6,9-10,12,18,21-22H,7-8,11H2,1H3 |
| InChIKey | OVFQWUKBBSAZTN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|