C21H24Cl2N2O3 — CID 139699361
methyl 2-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]indol-1-yl]acetate;hydrochloride (PubChem CID 139699361) has the molecular formula C21H24Cl2N2O3 and a molecular weight of 423.34 g/mol. Its IUPAC name is methyl 2-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]indol-1-yl]acetate;hydrochloride.
| Compound Name | methyl 2-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]indol-1-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 139699361 |
| Molecular Formula | C21H24Cl2N2O3 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | methyl 2-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]indol-1-yl]acetate;hydrochloride |
| SMILES | COC(=O)Cn1cc(CCNCC(O)c2cccc(Cl)c2)c2ccccc21.Cl |
| InChI | InChI=1S/C21H23ClN2O3.ClH/c1-27-21(26)14-24-13-16(18-7-2-3-8-19(18)24)9-10-23-12-20(25)15-5-4-6-17(22)11-15;/h2-8,11,13,20,23,25H,9-10,12,14H2,1H3;1H |
| InChIKey | NVSPJFRIAJSPPN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|