C18H24O4 — CID 7054072
cis-3-O-ethyl 1-O-phenyl (1R,3R)-1,2,2-trimethylcyclopentane-1,3-dicarboxylate (PubChem CID 7054072) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is cis-3-O-ethyl 1-O-phenyl (1R,3R)-1,2,2-trimethylcyclopentane-1,3-dicarboxylate.
| Compound Name | cis-3-O-ethyl 1-O-phenyl (1R,3R)-1,2,2-trimethylcyclopentane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7054072 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | cis-3-O-ethyl 1-O-phenyl (1R,3R)-1,2,2-trimethylcyclopentane-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@@](C)(C(=O)Oc2ccccc2)C1(C)C |
| InChI | InChI=1S/C18H24O4/c1-5-21-15(19)14-11-12-18(4,17(14,2)3)16(20)22-13-9-7-6-8-10-13/h6-10,14H,5,11-12H2,1-4H3/t14-,18-/m0/s1 |
| InChIKey | XCRWGOGPEPOQEN-KSSFIOAISA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|