C25H34N2O — CID 70542732
(Z)-3-(4-aminophenyl)-N-decyl-3-phenylprop-2-enamide (PubChem CID 70542732) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is (Z)-3-(4-aminophenyl)-N-decyl-3-phenylprop-2-enamide.
| Compound Name | (Z)-3-(4-aminophenyl)-N-decyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 70542732 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | (Z)-3-(4-aminophenyl)-N-decyl-3-phenylprop-2-enamide |
| SMILES | CCCCCCCCCCNC(=O)/C=C(/c1ccccc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C25H34N2O/c1-2-3-4-5-6-7-8-12-19-27-25(28)20-24(21-13-10-9-11-14-21)22-15-17-23(26)18-16-22/h9-11,13-18,20H,2-8,12,19,26H2,1H3,(H,27,28)/b24-20- |
| InChIKey | AIDQCZJLNXLPBK-GFMRDNFCSA-N |
| XLogP | 5.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|