C16H26N2O5SSi — CID 70543122
(5R,6S)-3-(2-acetamidoethylsulfanyl)-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 70543122) has the molecular formula C16H26N2O5SSi and a molecular weight of 386.55 g/mol. Its IUPAC name is (5R,6S)-3-(2-acetamidoethylsulfanyl)-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-3-(2-acetamidoethylsulfanyl)-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70543122 |
| Molecular Formula | C16H26N2O5SSi |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (5R,6S)-3-(2-acetamidoethylsulfanyl)-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CC(=O)NCCSC1=C(C(=O)O)N2C(=O)[C@H]([C@H](C)O[Si](C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C16H26N2O5SSi/c1-9(23-25(3,4)5)13-11-8-12(24-7-6-17-10(2)19)14(16(21)22)18(11)15(13)20/h9,11,13H,6-8H2,1-5H3,(H,17,19)(H,21,22)/t9-,11+,13+/m0/s1 |
| InChIKey | YFPKUPCHTZSROZ-UFGOTCBOSA-N |
| XLogP | 1.62 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|