C15H17N3O8S3 — CID 88737956
(5R,6R)-7-oxo-6-[(1S)-1-sulfooxyethyl]-3-[2-(1,2-thiazole-5-carbonylamino)ethylsulfanyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 88737956) has the molecular formula C15H17N3O8S3 and a molecular weight of 463.52 g/mol. Its IUPAC name is (5R,6R)-7-oxo-6-[(1S)-1-sulfooxyethyl]-3-[2-(1,2-thiazole-5-carbonylamino)ethylsulfanyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6R)-7-oxo-6-[(1S)-1-sulfooxyethyl]-3-[2-(1,2-thiazole-5-carbonylamino)ethylsulfanyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88737956 |
| Molecular Formula | C15H17N3O8S3 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | (5R,6R)-7-oxo-6-[(1S)-1-sulfooxyethyl]-3-[2-(1,2-thiazole-5-carbonylamino)ethylsulfanyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@H](OS(=O)(=O)O)[C@@H]1C(=O)N2C(C(=O)O)=C(SCCNC(=O)c3ccns3)C[C@H]12 |
| InChI | InChI=1S/C15H17N3O8S3/c1-7(26-29(23,24)25)11-8-6-10(12(15(21)22)18(8)14(11)20)27-5-4-16-13(19)9-2-3-17-28-9/h2-3,7-8,11H,4-6H2,1H3,(H,16,19)(H,21,22)(H,23,24,25)/t7-,8+,11-/m0/s1 |
| InChIKey | GFHXQTDJWQUSSZ-RNSXUZJQSA-N |
| XLogP | 0.34 |
| TPSA | 163.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|