C10H13NO7S2 — CID 88674701
(5R,6R)-3-methylsulfanyl-7-oxo-6-[(1S)-1-sulfooxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 88674701) has the molecular formula C10H13NO7S2 and a molecular weight of 323.35 g/mol. Its IUPAC name is (5R,6R)-3-methylsulfanyl-7-oxo-6-[(1S)-1-sulfooxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6R)-3-methylsulfanyl-7-oxo-6-[(1S)-1-sulfooxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88674701 |
| Molecular Formula | C10H13NO7S2 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | (5R,6R)-3-methylsulfanyl-7-oxo-6-[(1S)-1-sulfooxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CSC1=C(C(=O)O)N2C(=O)[C@@H]([C@H](C)OS(=O)(=O)O)[C@H]2C1 |
| InChI | InChI=1S/C10H13NO7S2/c1-4(18-20(15,16)17)7-5-3-6(19-2)8(10(13)14)11(5)9(7)12/h4-5,7H,3H2,1-2H3,(H,13,14)(H,15,16,17)/t4-,5+,7-/m0/s1 |
| InChIKey | VZTRVJDFNFLSCN-BFHQHQDPSA-N |
| XLogP | 0.08 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|