C29H52N6O7S2 — CID 88749355
[(1S)-1-[(5R,6R)-2-carboxy-3-[2-(5-methyltetrazol-1-yl)ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-en-6-yl]ethyl] sulfate;tetrabutylazanium (PubChem CID 88749355) has the molecular formula C29H52N6O7S2 and a molecular weight of 660.90 g/mol. Its IUPAC name is [(1S)-1-[(5R,6R)-2-carboxy-3-[2-(5-methyltetrazol-1-yl)ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-en-6-yl]ethyl] sulfate;tetrabutylazanium.
| Compound Name | [(1S)-1-[(5R,6R)-2-carboxy-3-[2-(5-methyltetrazol-1-yl)ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-en-6-yl]ethyl] sulfate;tetrabutylazanium |
|---|---|
| PubChem CID | 88749355 |
| Molecular Formula | C29H52N6O7S2 |
| Molecular Weight | 660.90 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | [(1S)-1-[(5R,6R)-2-carboxy-3-[2-(5-methyltetrazol-1-yl)ethylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-en-6-yl]ethyl] sulfate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Cc1nnnn1CCSC1=C(C(=O)O)N2C(=O)[C@@H]([C@H](C)OS(=O)(=O)[O-])[C@H]2C1 |
| InChI | InChI=1S/C16H36N.C13H17N5O7S2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-6(25-27(22,23)24)10-8-5-9(11(13(20)21)18(8)12(10)19)26-4-3-17-7(2)14-15-16-17/h5-16H2,1-4H3;6,8,10H,3-5H2,1-2H3,(H,20,21)(H,22,23,24)/q+1;/p-1/t;6-,8+,10-/m.0/s1 |
| InChIKey | FVYXRRVCTXYWSO-HYCOMVCOSA-M |
| XLogP | 4.11 |
| TPSA | 167.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|