C13H16N2O4S — CID 70575104
(5R,6E)-3-(2-acetamidoethylsulfanyl)-6-ethylidene-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 70575104) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is (5R,6E)-3-(2-acetamidoethylsulfanyl)-6-ethylidene-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6E)-3-(2-acetamidoethylsulfanyl)-6-ethylidene-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70575104 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (5R,6E)-3-(2-acetamidoethylsulfanyl)-6-ethylidene-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C/C=C1/C(=O)N2C(C(=O)O)=C(SCCNC(C)=O)C[C@H]12 |
| InChI | InChI=1S/C13H16N2O4S/c1-3-8-9-6-10(20-5-4-14-7(2)16)11(13(18)19)15(9)12(8)17/h3,9H,4-6H2,1-2H3,(H,14,16)(H,18,19)/b8-3+/t9-/m1/s1 |
| InChIKey | PIDRWBZRZDCTGM-QZGLAHODSA-N |
| XLogP | 0.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|