C19H21O5P — CID 70543978
(4-butylphenyl) (1-oxo-2,3-dihydroinden-4-yl) hydrogen phosphate (PubChem CID 70543978) has the molecular formula C19H21O5P and a molecular weight of 360.35 g/mol. Its IUPAC name is (4-butylphenyl) (1-oxo-2,3-dihydroinden-4-yl) hydrogen phosphate.
| Compound Name | (4-butylphenyl) (1-oxo-2,3-dihydroinden-4-yl) hydrogen phosphate |
|---|---|
| PubChem CID | 70543978 |
| Molecular Formula | C19H21O5P |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (4-butylphenyl) (1-oxo-2,3-dihydroinden-4-yl) hydrogen phosphate |
| SMILES | CCCCc1ccc(OP(=O)(O)Oc2cccc3c2CCC3=O)cc1 |
| InChI | InChI=1S/C19H21O5P/c1-2-3-5-14-8-10-15(11-9-14)23-25(21,22)24-19-7-4-6-16-17(19)12-13-18(16)20/h4,6-11H,2-3,5,12-13H2,1H3,(H,21,22) |
| InChIKey | SEFRMSUOQWRXLH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|