C21H25O3PS3 — CID 57123369
4-[(4-hexylsulfanylphenyl)sulfanyl-hydroxyphosphinothioyl]oxy-2,3-dihydroinden-1-one (PubChem CID 57123369) has the molecular formula C21H25O3PS3 and a molecular weight of 452.60 g/mol. Its IUPAC name is 4-[(4-hexylsulfanylphenyl)sulfanyl-hydroxyphosphinothioyl]oxy-2,3-dihydroinden-1-one.
| Compound Name | 4-[(4-hexylsulfanylphenyl)sulfanyl-hydroxyphosphinothioyl]oxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 57123369 |
| Molecular Formula | C21H25O3PS3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 4-[(4-hexylsulfanylphenyl)sulfanyl-hydroxyphosphinothioyl]oxy-2,3-dihydroinden-1-one |
| SMILES | CCCCCCSc1ccc(SP(O)(=S)Oc2cccc3c2CCC3=O)cc1 |
| InChI | InChI=1S/C21H25O3PS3/c1-2-3-4-5-15-27-16-9-11-17(12-10-16)28-25(23,26)24-21-8-6-7-18-19(21)13-14-20(18)22/h6-12H,2-5,13-15H2,1H3,(H,23,26) |
| InChIKey | UNKGGTAWSSRQMG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|