C27H36O3 — CID 70544901
(8R,9R,10R,13S,14S)-4-benzoyl-17-(hydroxymethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70544901) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-4-benzoyl-17-(hydroxymethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13S,14S)-4-benzoyl-17-(hydroxymethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70544901 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (8R,9R,10R,13S,14S)-4-benzoyl-17-(hydroxymethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C(C(=O)c3ccccc3)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(CO)CC[C@@H]12 |
| InChI | InChI=1S/C27H36O3/c1-26-14-12-21-19(20(26)10-8-18(26)16-28)9-11-22-24(23(29)13-15-27(21,22)2)25(30)17-6-4-3-5-7-17/h3-7,18-22,24,28H,8-16H2,1-2H3/t18?,19-,20-,21+,22?,24?,26+,27+/m0/s1 |
| InChIKey | VRTXSXFGQAWLIM-QPUBJEGRSA-N |
| XLogP | 5.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|