C12H7LiN2O6 — CID 70545414
lithium 3-(3-carboxyphenyl)-2,4-dioxo-1H-pyrimidine-6-carboxylate (PubChem CID 70545414) has the molecular formula C12H7LiN2O6 and a molecular weight of 282.14 g/mol. Its IUPAC name is lithium 3-(3-carboxyphenyl)-2,4-dioxo-1H-pyrimidine-6-carboxylate.
| Compound Name | lithium 3-(3-carboxyphenyl)-2,4-dioxo-1H-pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 70545414 |
| Molecular Formula | C12H7LiN2O6 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | lithium 3-(3-carboxyphenyl)-2,4-dioxo-1H-pyrimidine-6-carboxylate |
| SMILES | O=C(O)c1cccc(-n2c(=O)cc(C(=O)[O-])[nH]c2=O)c1.[Li+] |
| InChI | InChI=1S/C12H8N2O6.Li/c15-9-5-8(11(18)19)13-12(20)14(9)7-3-1-2-6(4-7)10(16)17;/h1-5H,(H,13,20)(H,16,17)(H,18,19);/q;+1/p-1 |
| InChIKey | VMGACTUHTKWOOM-UHFFFAOYSA-M |
| XLogP | -4.41 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |