C14H16N6O6 — CID 57288153
3-[5-[3-[carbamimidoyl(nitro)amino]propyl]-4-hydroxy-2-oxo-1H-imidazol-3-yl]benzoic acid (PubChem CID 57288153) has the molecular formula C14H16N6O6 and a molecular weight of 364.32 g/mol. Its IUPAC name is 3-[5-[3-[carbamimidoyl(nitro)amino]propyl]-4-hydroxy-2-oxo-1H-imidazol-3-yl]benzoic acid.
| Compound Name | 3-[5-[3-[carbamimidoyl(nitro)amino]propyl]-4-hydroxy-2-oxo-1H-imidazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 57288153 |
| Molecular Formula | C14H16N6O6 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-[5-[3-[carbamimidoyl(nitro)amino]propyl]-4-hydroxy-2-oxo-1H-imidazol-3-yl]benzoic acid |
| SMILES | [H]/N=C(\N)N(CCCc1[nH]c(=O)n(-c2cccc(C(=O)O)c2)c1O)[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N6O6/c15-13(16)18(20(25)26)6-2-5-10-11(21)19(14(24)17-10)9-4-1-3-8(7-9)12(22)23/h1,3-4,7,21H,2,5-6H2,(H3,15,16)(H,17,24)(H,22,23) |
| InChIKey | VORJJGIFWPWHAK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 191.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|