C26H47N3O2 — CID 70548159
3-ethyl-5-methyl-1,2,3,6-tetrahydro-1,4-diazepin-7-one;5-tetradec-5-enylpyrrolidin-2-one (PubChem CID 70548159) has the molecular formula C26H47N3O2 and a molecular weight of 433.68 g/mol. Its IUPAC name is 3-ethyl-5-methyl-1,2,3,6-tetrahydro-1,4-diazepin-7-one;5-tetradec-5-enylpyrrolidin-2-one.
| Compound Name | 3-ethyl-5-methyl-1,2,3,6-tetrahydro-1,4-diazepin-7-one;5-tetradec-5-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 70548159 |
| Molecular Formula | C26H47N3O2 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.37 |
| IUPAC Name | 3-ethyl-5-methyl-1,2,3,6-tetrahydro-1,4-diazepin-7-one;5-tetradec-5-enylpyrrolidin-2-one |
| SMILES | CCC1CNC(=O)CC(C)=N1.CCCCCCCCC=CCCCCC1CCC(=O)N1 |
| InChI | InChI=1S/C18H33NO.C8H14N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-15-16-18(20)19-17;1-3-7-5-9-8(11)4-6(2)10-7/h9-10,17H,2-8,11-16H2,1H3,(H,19,20);7H,3-5H2,1-2H3,(H,9,11) |
| InChIKey | YCSXZTIEBJWJMO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|