C20H20Cl2N2 — CID 70550287
1-(4-methylphenyl)-2H-benzo[a]quinolizin-2-amine;dihydrochloride (PubChem CID 70550287) has the molecular formula C20H20Cl2N2 and a molecular weight of 359.30 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2H-benzo[a]quinolizin-2-amine;dihydrochloride.
| Compound Name | 1-(4-methylphenyl)-2H-benzo[a]quinolizin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 70550287 |
| Molecular Formula | C20H20Cl2N2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-(4-methylphenyl)-2H-benzo[a]quinolizin-2-amine;dihydrochloride |
| SMILES | Cc1ccc(C2=C3c4ccccc4C=CN3C=CC2N)cc1.Cl.Cl |
| InChI | InChI=1S/C20H18N2.2ClH/c1-14-6-8-16(9-7-14)19-18(21)11-13-22-12-10-15-4-2-3-5-17(15)20(19)22;;/h2-13,18H,21H2,1H3;2*1H |
| InChIKey | AXTJZYLNKOEXMD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|