C27H47NO3 — CID 70552030
4-ethyl-1-[[(Z)-octadec-9-enoxy]methyl]-2H-pyridine-3-carboxylic acid (PubChem CID 70552030) has the molecular formula C27H47NO3 and a molecular weight of 433.68 g/mol. Its IUPAC name is 4-ethyl-1-[[(Z)-octadec-9-enoxy]methyl]-2H-pyridine-3-carboxylic acid.
| Compound Name | 4-ethyl-1-[[(Z)-octadec-9-enoxy]methyl]-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70552030 |
| Molecular Formula | C27H47NO3 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.36 |
| IUPAC Name | 4-ethyl-1-[[(Z)-octadec-9-enoxy]methyl]-2H-pyridine-3-carboxylic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCN1C=CC(CC)=C(C(=O)O)C1 |
| InChI | InChI=1S/C27H47NO3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-31-24-28-21-20-25(4-2)26(23-28)27(29)30/h11-12,20-21H,3-10,13-19,22-24H2,1-2H3,(H,29,30)/b12-11- |
| InChIKey | WOGJCHHQYGKSEJ-QXMHVHEDSA-N |
| XLogP | 7.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|