C11H12F3N3 — CID 70552248
N-(1,2,2-trifluoro-1-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 70552248) has the molecular formula C11H12F3N3 and a molecular weight of 243.23 g/mol. Its IUPAC name is N-(1,2,2-trifluoro-1-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(1,2,2-trifluoro-1-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 70552248 |
| Molecular Formula | C11H12F3N3 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-(1,2,2-trifluoro-1-phenylethyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | FC(F)C(F)(NC1=NCCN1)c1ccccc1 |
| InChI | InChI=1S/C11H12F3N3/c12-9(13)11(14,8-4-2-1-3-5-8)17-10-15-6-7-16-10/h1-5,9H,6-7H2,(H2,15,16,17) |
| InChIKey | HKBHQSCTMOPXSF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|