About [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate
[6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate (PubChem CID 70552325) has the molecular formula C18H11Cl2F3N2O2
and a molecular weight of 415.20 g/mol. Its IUPAC name is [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate.
Molecular Properties
| Compound Name | [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate |
| PubChem CID | 70552325 |
| Molecular Formula | C18H11Cl2F3N2O2 |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate |
| SMILES | CC(=O)OCc1c(-c2ccccn2)c(C(F)(F)F)nc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C18H11Cl2F3N2O2/c1-9(26)27-8-12-11-6-10(19)7-13(20)16(11)25-17(18(21,22)23)15(12)14-4-2-3-5-24-14/h2-7H,8H2,1H3 |
| InChIKey | TVZCUPMZOJVACG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate?
The IUPAC name of [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate (CID 70552325) is [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate.
What is the SMILES notation for [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate?
The canonical SMILES for [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate is CC(=O)OCc1c(-c2ccccn2)c(C(F)(F)F)nc2c(Cl)cc(Cl)cc12.
What is the InChIKey of [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate?
The InChIKey is TVZCUPMZOJVACG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2F3N2O2/c1-9(26)27-8-12-11-6-10(19)7-13(20)16(11)25-17(18(21,22)23)15(12)14-4-2-3-5-24-14/h2-7H,8H2,1H3.
What are the key properties of [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate?
[6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate has a molecular weight of 415.20 g/mol, XLogP of 5.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6,8-dichloro-3-pyridin-2-yl-2-(trifluoromethyl)quinolin-4-yl]methyl acetate is sourced from PubChem (CID 70552325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).