C22H32N4O9 — CID 70555141
[3-[4-[3-[(dimethylamino)methyl]phenoxy]butyl]-1H-1,2,4-triazol-5-yl]methanol;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 70555141) has the molecular formula C22H32N4O9 and a molecular weight of 496.52 g/mol. Its IUPAC name is [3-[4-[3-[(dimethylamino)methyl]phenoxy]butyl]-1H-1,2,4-triazol-5-yl]methanol;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | [3-[4-[3-[(dimethylamino)methyl]phenoxy]butyl]-1H-1,2,4-triazol-5-yl]methanol;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 70555141 |
| Molecular Formula | C22H32N4O9 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | [3-[4-[3-[(dimethylamino)methyl]phenoxy]butyl]-1H-1,2,4-triazol-5-yl]methanol;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)Cc1cccc(OCCCCc2n[nH]c(CO)n2)c1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H24N4O2.C6H8O7/c1-20(2)11-13-6-5-7-14(10-13)22-9-4-3-8-15-17-16(12-21)19-18-15;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-7,10,21H,3-4,8-9,11-12H2,1-2H3,(H,17,18,19);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | OLFCBUIPSYSJAY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 206.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|