C14H21N4O3+ — CID 70555404
3-tert-butyl-5-(5-hydroxy-2-oxo-1-propylimidazolidin-1-ium-1-yl)-1,2-oxazole-4-carbonitrile (PubChem CID 70555404) has the molecular formula C14H21N4O3+ and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-tert-butyl-5-(5-hydroxy-2-oxo-1-propylimidazolidin-1-ium-1-yl)-1,2-oxazole-4-carbonitrile.
| Compound Name | 3-tert-butyl-5-(5-hydroxy-2-oxo-1-propylimidazolidin-1-ium-1-yl)-1,2-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 70555404 |
| Molecular Formula | C14H21N4O3+ |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-tert-butyl-5-(5-hydroxy-2-oxo-1-propylimidazolidin-1-ium-1-yl)-1,2-oxazole-4-carbonitrile |
| SMILES | CCC[N+]1(c2onc(C(C)(C)C)c2C#N)C(=O)NCC1O |
| InChI | InChI=1S/C14H20N4O3/c1-5-6-18(10(19)8-16-13(18)20)12-9(7-15)11(17-21-12)14(2,3)4/h10,19H,5-6,8H2,1-4H3/p+1 |
| InChIKey | XGCMYBGDFLGELO-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|