C35H29F2NO5S — CID 70556144
[2-(4-hydroxyphenyl)-3-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]benzoyl]-1-benzothiophen-6-yl] 2,5-difluorobenzoate (PubChem CID 70556144) has the molecular formula C35H29F2NO5S and a molecular weight of 613.68 g/mol. Its IUPAC name is [2-(4-hydroxyphenyl)-3-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]benzoyl]-1-benzothiophen-6-yl] 2,5-difluorobenzoate.
| Compound Name | [2-(4-hydroxyphenyl)-3-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]benzoyl]-1-benzothiophen-6-yl] 2,5-difluorobenzoate |
|---|---|
| PubChem CID | 70556144 |
| Molecular Formula | C35H29F2NO5S |
| Molecular Weight | 613.68 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | [2-(4-hydroxyphenyl)-3-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]benzoyl]-1-benzothiophen-6-yl] 2,5-difluorobenzoate |
| SMILES | CC1CCN(CCOc2ccc(C(=O)c3c(-c4ccc(O)cc4)sc4cc(OC(=O)c5cc(F)ccc5F)ccc34)cc2)C1 |
| InChI | InChI=1S/C35H29F2NO5S/c1-21-14-15-38(20-21)16-17-42-26-9-4-22(5-10-26)33(40)32-28-12-11-27(43-35(41)29-18-24(36)6-13-30(29)37)19-31(28)44-34(32)23-2-7-25(39)8-3-23/h2-13,18-19,21,39H,14-17,20H2,1H3 |
| InChIKey | XHLYGXYUUDPVDP-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.68 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|