C40H37Cl2NO5S — CID 70553859
[4-[6-cyclopentyloxy-3-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]benzoyl]-1-benzothiophen-2-yl]phenyl] 2,4-dichlorobenzoate (PubChem CID 70553859) has the molecular formula C40H37Cl2NO5S and a molecular weight of 714.71 g/mol. Its IUPAC name is [4-[6-cyclopentyloxy-3-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]benzoyl]-1-benzothiophen-2-yl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[6-cyclopentyloxy-3-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]benzoyl]-1-benzothiophen-2-yl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 70553859 |
| Molecular Formula | C40H37Cl2NO5S |
| Molecular Weight | 714.71 g/mol |
| Exact Mass | 713.18 |
| IUPAC Name | [4-[6-cyclopentyloxy-3-[4-[2-(3-methylpyrrolidin-1-yl)ethoxy]benzoyl]-1-benzothiophen-2-yl]phenyl] 2,4-dichlorobenzoate |
| SMILES | CC1CCN(CCOc2ccc(C(=O)c3c(-c4ccc(OC(=O)c5ccc(Cl)cc5Cl)cc4)sc4cc(OC5CCCC5)ccc34)cc2)C1 |
| InChI | InChI=1S/C40H37Cl2NO5S/c1-25-18-19-43(24-25)20-21-46-29-11-6-26(7-12-29)38(44)37-34-17-15-32(47-30-4-2-3-5-30)23-36(34)49-39(37)27-8-13-31(14-9-27)48-40(45)33-16-10-28(41)22-35(33)42/h6-17,22-23,25,30H,2-5,18-21,24H2,1H3 |
| InChIKey | JPXRBMADCKDPID-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.71 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|