C36H42FN3O3 — CID 70558097
(6R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-6-[5-(butylamino)-2-fluorophenyl]-6-methylmorpholin-2-amine (PubChem CID 70558097) has the molecular formula C36H42FN3O3 and a molecular weight of 583.75 g/mol. Its IUPAC name is (6R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-6-[5-(butylamino)-2-fluorophenyl]-6-methylmorpholin-2-amine.
| Compound Name | (6R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-6-[5-(butylamino)-2-fluorophenyl]-6-methylmorpholin-2-amine |
|---|---|
| PubChem CID | 70558097 |
| Molecular Formula | C36H42FN3O3 |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.32 |
| IUPAC Name | (6R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-6-[5-(butylamino)-2-fluorophenyl]-6-methylmorpholin-2-amine |
| SMILES | CCCCNc1ccc(F)c([C@]2(C)CNCC(NC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O2)c1 |
| InChI | InChI=1S/C36H42FN3O3/c1-5-6-22-39-29-16-21-33(37)32(23-29)35(2)25-38-24-34(43-35)40-36(26-10-8-7-9-11-26,27-12-17-30(41-3)18-13-27)28-14-19-31(42-4)20-15-28/h7-21,23,34,38-40H,5-6,22,24-25H2,1-4H3/t34?,35-/m0/s1 |
| InChIKey | NPPCODBBNDQLTH-HTIIIDOHSA-N |
| XLogP | 6.80 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|