C44H58S3Si — CID 70558560
CID 70558560 (PubChem CID 70558560) has the molecular formula C44H58S3Si and a molecular weight of 711.23 g/mol.
| Compound Name | CID 70558560 |
|---|---|
| PubChem CID | 70558560 |
| Molecular Formula | C44H58S3Si |
| Molecular Weight | 711.23 g/mol |
| Exact Mass | 710.35 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC1=Cc2sc3c(c2[Si]1)C(CC)(CC)c1cc2c(cc1-3)C(CC)(CC)c1c-2sc2cc(CCCCCCCC)sc12 |
| InChI | InChI=1S/C44H58S3Si/c1-7-13-15-17-19-21-23-29-25-35-41(45-29)37-39(46-35)31-27-34-32(28-33(31)43(37,9-3)10-4)40-38(44(34,11-5)12-6)42-36(47-40)26-30(48-42)24-22-20-18-16-14-8-2/h25-28H,7-24H2,1-6H3 |
| InChIKey | QRDIMXCYXCXBTD-UHFFFAOYSA-N |
| XLogP | 14.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.23 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|