C29H39ClN8O2Si — CID 70558907
3-[6-[(3-chlorophenyl)methylamino]-2-pyridinyl]-N-(2-morpholin-4-ylethyl)-4-(2-trimethylsilylethoxymethyl)-2H-pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 70558907) has the molecular formula C29H39ClN8O2Si and a molecular weight of 595.22 g/mol. Its IUPAC name is 3-[6-[(3-chlorophenyl)methylamino]-2-pyridinyl]-N-(2-morpholin-4-ylethyl)-4-(2-trimethylsilylethoxymethyl)-2H-pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 3-[6-[(3-chlorophenyl)methylamino]-2-pyridinyl]-N-(2-morpholin-4-ylethyl)-4-(2-trimethylsilylethoxymethyl)-2H-pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 70558907 |
| Molecular Formula | C29H39ClN8O2Si |
| Molecular Weight | 595.22 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 3-[6-[(3-chlorophenyl)methylamino]-2-pyridinyl]-N-(2-morpholin-4-ylethyl)-4-(2-trimethylsilylethoxymethyl)-2H-pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | C[Si](C)(C)CCOCc1nc(NCCN2CCOCC2)nc2n[nH]c(-c3cccc(NCc4cccc(Cl)c4)n3)c12 |
| InChI | InChI=1S/C29H39ClN8O2Si/c1-41(2,3)17-16-40-20-24-26-27(23-8-5-9-25(33-23)32-19-21-6-4-7-22(30)18-21)36-37-28(26)35-29(34-24)31-10-11-38-12-14-39-15-13-38/h4-9,18H,10-17,19-20H2,1-3H3,(H,32,33)(H2,31,34,35,36,37) |
| InChIKey | MSCBMFONOLSDIB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.22 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|