C25H29ClFN3O6 — CID 70560071
methyl 3-[2-chloro-5-[2-(3-fluorophenyl)ethyl-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbamoyl]anilino]-3-oxopropanoate (PubChem CID 70560071) has the molecular formula C25H29ClFN3O6 and a molecular weight of 521.97 g/mol. Its IUPAC name is methyl 3-[2-chloro-5-[2-(3-fluorophenyl)ethyl-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbamoyl]anilino]-3-oxopropanoate.
| Compound Name | methyl 3-[2-chloro-5-[2-(3-fluorophenyl)ethyl-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbamoyl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 70560071 |
| Molecular Formula | C25H29ClFN3O6 |
| Molecular Weight | 521.97 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | methyl 3-[2-chloro-5-[2-(3-fluorophenyl)ethyl-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbamoyl]anilino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1cc(C(=O)N(CCc2cccc(F)c2)CNC(=O)OC(C)(C)C)ccc1Cl |
| InChI | InChI=1S/C25H29ClFN3O6/c1-25(2,3)36-24(34)28-15-30(11-10-16-6-5-7-18(27)12-16)23(33)17-8-9-19(26)20(13-17)29-21(31)14-22(32)35-4/h5-9,12-13H,10-11,14-15H2,1-4H3,(H,28,34)(H,29,31) |
| InChIKey | VHBAYECIIOCILB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.97 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|