C17H17ClFN3O2 — CID 70557880
1-N-(aminomethyl)-4-chloro-1-N-[2-(3-fluorophenyl)ethyl]benzene-1,3-dicarboxamide (PubChem CID 70557880) has the molecular formula C17H17ClFN3O2 and a molecular weight of 349.79 g/mol. Its IUPAC name is 1-N-(aminomethyl)-4-chloro-1-N-[2-(3-fluorophenyl)ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N-(aminomethyl)-4-chloro-1-N-[2-(3-fluorophenyl)ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 70557880 |
| Molecular Formula | C17H17ClFN3O2 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 1-N-(aminomethyl)-4-chloro-1-N-[2-(3-fluorophenyl)ethyl]benzene-1,3-dicarboxamide |
| SMILES | NCN(CCc1cccc(F)c1)C(=O)c1ccc(Cl)c(C(N)=O)c1 |
| InChI | InChI=1S/C17H17ClFN3O2/c18-15-5-4-12(9-14(15)16(21)23)17(24)22(10-20)7-6-11-2-1-3-13(19)8-11/h1-5,8-9H,6-7,10,20H2,(H2,21,23) |
| InChIKey | OLVOJHSJWNDOHB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|