C19H30N5O3PS — CID 70562381
1-[ethoxy(phenylmethoxy)phosphoryl]-2,3-dimethyl-1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine (PubChem CID 70562381) has the molecular formula C19H30N5O3PS and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-[ethoxy(phenylmethoxy)phosphoryl]-2,3-dimethyl-1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-[ethoxy(phenylmethoxy)phosphoryl]-2,3-dimethyl-1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 70562381 |
| Molecular Formula | C19H30N5O3PS |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 1-[ethoxy(phenylmethoxy)phosphoryl]-2,3-dimethyl-1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine |
| SMILES | CCOP(=O)(OCc1ccccc1)N(CCSCc1nc[nH]c1C)/C(=N/C)NC |
| InChI | InChI=1S/C19H30N5O3PS/c1-5-26-28(25,27-13-17-9-7-6-8-10-17)24(19(20-3)21-4)11-12-29-14-18-16(2)22-15-23-18/h6-10,15H,5,11-14H2,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | ZEDIVBPVCBFLFN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|