C15H21ClN2S — CID 3076439
5-methyl-4-(4-phenylbutylsulfanylmethyl)-1H-imidazole;hydrochloride (PubChem CID 3076439) has the molecular formula C15H21ClN2S and a molecular weight of 296.87 g/mol. Its IUPAC name is 5-methyl-4-(4-phenylbutylsulfanylmethyl)-1H-imidazole;hydrochloride.
| Compound Name | 5-methyl-4-(4-phenylbutylsulfanylmethyl)-1H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 3076439 |
| Molecular Formula | C15H21ClN2S |
| Molecular Weight | 296.87 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 5-methyl-4-(4-phenylbutylsulfanylmethyl)-1H-imidazole;hydrochloride |
| SMILES | Cc1[nH]cnc1CSCCCCc1ccccc1.Cl |
| InChI | InChI=1S/C15H20N2S.ClH/c1-13-15(17-12-16-13)11-18-10-6-5-9-14-7-3-2-4-8-14;/h2-4,7-8,12H,5-6,9-11H2,1H3,(H,16,17);1H |
| InChIKey | PDDXAJBCNAAMCX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|