C24H30ClFO6 — CID 70562558
[2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-4-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 70562558) has the molecular formula C24H30ClFO6 and a molecular weight of 468.95 g/mol. Its IUPAC name is [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-4-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-4-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 70562558 |
| Molecular Formula | C24H30ClFO6 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-4-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)[C@H](C)C[C@H]2[C@@H]3CCC4=C(F)C(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C24H30ClFO6/c1-12-9-16-14-5-6-15-20(26)17(28)7-8-21(15,3)23(14,25)18(29)10-22(16,4)24(12,31)19(30)11-32-13(2)27/h7-8,12,14,16,18,29,31H,5-6,9-11H2,1-4H3/t12-,14+,16+,18+,21+,22+,23+,24+/m1/s1 |
| InChIKey | RCZKZNFWSZPGBY-XGGQOPQVSA-N |
| XLogP | 3.03 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|