C23H27ClF2O6 — CID 70563077
[2-[(8S,9R,10S,13S,14S,17R)-7-chloro-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 70563077) has the molecular formula C23H27ClF2O6 and a molecular weight of 472.91 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,17R)-7-chloro-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,17R)-7-chloro-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 70563077 |
| Molecular Formula | C23H27ClF2O6 |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,17R)-7-chloro-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C(Cl)C(F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C23H27ClF2O6/c1-11(27)32-10-16(30)22(31)7-5-13-17-18(24)19(25)14-8-12(28)4-6-20(14,2)23(17,26)15(29)9-21(13,22)3/h4,6,8,13,15,17-19,29,31H,5,7,9-10H2,1-3H3/t13-,15?,17+,18?,19?,20-,21-,22-,23+/m0/s1 |
| InChIKey | MJOIQKDZGVHHQW-ARJWSXCRSA-N |
| XLogP | 2.39 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|