C24H27ClF2O5 — CID 22815973
[2-[(6S,7S,8S,9R,10S,11S,13S,14S)-7-chloro-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 22815973) has the molecular formula C24H27ClF2O5 and a molecular weight of 468.92 g/mol. Its IUPAC name is [2-[(6S,7S,8S,9R,10S,11S,13S,14S)-7-chloro-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(6S,7S,8S,9R,10S,11S,13S,14S)-7-chloro-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 22815973 |
| Molecular Formula | C24H27ClF2O5 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | [2-[(6S,7S,8S,9R,10S,11S,13S,14S)-7-chloro-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)C1=C(C)C[C@H]2[C@@H]3[C@H](Cl)[C@@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C |
| InChI | InChI=1S/C24H27ClF2O5/c1-11-7-14-19-20(25)21(26)15-8-13(29)5-6-23(15,4)24(19,27)17(31)9-22(14,3)18(11)16(30)10-32-12(2)28/h5-6,8,14,17,19-21,31H,7,9-10H2,1-4H3/t14-,17-,19+,20-,21-,22-,23-,24+/m0/s1 |
| InChIKey | HQOMETDPKGHDQK-ZPZJBKQJSA-N |
| XLogP | 3.58 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|