C12H10N4 — CID 70564764
benzo[h]quinazoline-2,4-diamine (PubChem CID 70564764) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is benzo[h]quinazoline-2,4-diamine.
| Compound Name | benzo[h]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 70564764 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | benzo[h]quinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2ccc3ccccc3c2n1 |
| InChI | InChI=1S/C12H10N4/c13-11-9-6-5-7-3-1-2-4-8(7)10(9)15-12(14)16-11/h1-6H,(H4,13,14,15,16) |
| InChIKey | BWEIJWJENIQMPG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|