C7H10N2O — CID 70565491
3-methyl-1-prop-2-enylpyrazol-4-ol (PubChem CID 70565491) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-methyl-1-prop-2-enylpyrazol-4-ol.
| Compound Name | 3-methyl-1-prop-2-enylpyrazol-4-ol |
|---|---|
| PubChem CID | 70565491 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 3-methyl-1-prop-2-enylpyrazol-4-ol |
| SMILES | C=CCn1cc(O)c(C)n1 |
| InChI | InChI=1S/C7H10N2O/c1-3-4-9-5-7(10)6(2)8-9/h3,5,10H,1,4H2,2H3 |
| InChIKey | FMGGYYUQWLBNMY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|