C13H20N6 — CID 46995894
N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-3-(1,2,4-triazol-1-yl)propan-1-amine (PubChem CID 46995894) has the molecular formula C13H20N6 and a molecular weight of 260.35 g/mol. Its IUPAC name is N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-3-(1,2,4-triazol-1-yl)propan-1-amine.
| Compound Name | N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-3-(1,2,4-triazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 46995894 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | N-[(3-methyl-1-prop-2-enylpyrazol-4-yl)methyl]-3-(1,2,4-triazol-1-yl)propan-1-amine |
| SMILES | C=CCn1cc(CNCCCn2cncn2)c(C)n1 |
| InChI | InChI=1S/C13H20N6/c1-3-6-18-9-13(12(2)17-18)8-14-5-4-7-19-11-15-10-16-19/h3,9-11,14H,1,4-8H2,2H3 |
| InChIKey | QTVMITCVWUMHNU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|