C15H16ClF2N3 — CID 46993041
N-[(3-chloro-2,6-difluorophenyl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine (PubChem CID 46993041) has the molecular formula C15H16ClF2N3 and a molecular weight of 311.76 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 46993041 |
| Molecular Formula | C15H16ClF2N3 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)methyl]-1-(3-methyl-1-prop-2-enylpyrazol-4-yl)methanamine |
| SMILES | C=CCn1cc(CNCc2c(F)ccc(Cl)c2F)c(C)n1 |
| InChI | InChI=1S/C15H16ClF2N3/c1-3-6-21-9-11(10(2)20-21)7-19-8-12-14(17)5-4-13(16)15(12)18/h3-5,9,19H,1,6-8H2,2H3 |
| InChIKey | ROKKNCCORPWXMY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|